About [4-(2-methylphenyl)-1,3-thiazol-2-yl]methylhydrazine
[4-(2-methylphenyl)-1,3-thiazol-2-yl]methylhydrazine (PubChem CID 53275090) has the molecular formula C11H13N3S
and a molecular weight of 219.31 g/mol. Its IUPAC name is [4-(2-methylphenyl)-1,3-thiazol-2-yl]methylhydrazine.
Molecular Properties
| Compound Name | [4-(2-methylphenyl)-1,3-thiazol-2-yl]methylhydrazine |
| PubChem CID | 53275090 |
| Molecular Formula | C11H13N3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | [4-(2-methylphenyl)-1,3-thiazol-2-yl]methylhydrazine |
| SMILES | Cc1ccccc1-c1csc(CNN)n1 |
| InChI | InChI=1S/C11H13N3S/c1-8-4-2-3-5-9(8)10-7-15-11(14-10)6-13-12/h2-5,7,13H,6,12H2,1H3 |
| InChIKey | NJPLSMZPQGTLEA-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [4-(2-methylphenyl)-1,3-thiazol-2-yl]methylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2-methylphenyl)-1,3-thiazol-2-yl]methylhydrazine?
The IUPAC name of [4-(2-methylphenyl)-1,3-thiazol-2-yl]methylhydrazine (CID 53275090) is [4-(2-methylphenyl)-1,3-thiazol-2-yl]methylhydrazine.
What is the SMILES notation for [4-(2-methylphenyl)-1,3-thiazol-2-yl]methylhydrazine?
The canonical SMILES for [4-(2-methylphenyl)-1,3-thiazol-2-yl]methylhydrazine is Cc1ccccc1-c1csc(CNN)n1.
What is the InChIKey of [4-(2-methylphenyl)-1,3-thiazol-2-yl]methylhydrazine?
The InChIKey is NJPLSMZPQGTLEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3S/c1-8-4-2-3-5-9(8)10-7-15-11(14-10)6-13-12/h2-5,7,13H,6,12H2,1H3.
What are the key properties of [4-(2-methylphenyl)-1,3-thiazol-2-yl]methylhydrazine?
[4-(2-methylphenyl)-1,3-thiazol-2-yl]methylhydrazine has a molecular weight of 219.31 g/mol, XLogP of 2.08, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2-methylphenyl)-1,3-thiazol-2-yl]methylhydrazine is sourced from PubChem (CID 53275090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).