About (2-methoxy-4-methyl-1,3-thiazol-5-yl)methylhydrazine
(2-methoxy-4-methyl-1,3-thiazol-5-yl)methylhydrazine (PubChem CID 53275224) has the molecular formula C6H11N3OS
and a molecular weight of 173.24 g/mol. Its IUPAC name is (2-methoxy-4-methyl-1,3-thiazol-5-yl)methylhydrazine.
Molecular Properties
| Compound Name | (2-methoxy-4-methyl-1,3-thiazol-5-yl)methylhydrazine |
| PubChem CID | 53275224 |
| Molecular Formula | C6H11N3OS |
| Molecular Weight | 173.24 g/mol |
| Exact Mass | 173.06 |
| IUPAC Name | (2-methoxy-4-methyl-1,3-thiazol-5-yl)methylhydrazine |
| SMILES | COc1nc(C)c(CNN)s1 |
| InChI | InChI=1S/C6H11N3OS/c1-4-5(3-8-7)11-6(9-4)10-2/h8H,3,7H2,1-2H3 |
| InChIKey | WJHUNGPZXMXUHG-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.24 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-methoxy-4-methyl-1,3-thiazol-5-yl)methylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methoxy-4-methyl-1,3-thiazol-5-yl)methylhydrazine?
The IUPAC name of (2-methoxy-4-methyl-1,3-thiazol-5-yl)methylhydrazine (CID 53275224) is (2-methoxy-4-methyl-1,3-thiazol-5-yl)methylhydrazine.
What is the SMILES notation for (2-methoxy-4-methyl-1,3-thiazol-5-yl)methylhydrazine?
The canonical SMILES for (2-methoxy-4-methyl-1,3-thiazol-5-yl)methylhydrazine is COc1nc(C)c(CNN)s1.
What is the InChIKey of (2-methoxy-4-methyl-1,3-thiazol-5-yl)methylhydrazine?
The InChIKey is WJHUNGPZXMXUHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3OS/c1-4-5(3-8-7)11-6(9-4)10-2/h8H,3,7H2,1-2H3.
What are the key properties of (2-methoxy-4-methyl-1,3-thiazol-5-yl)methylhydrazine?
(2-methoxy-4-methyl-1,3-thiazol-5-yl)methylhydrazine has a molecular weight of 173.24 g/mol, XLogP of 0.42, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methoxy-4-methyl-1,3-thiazol-5-yl)methylhydrazine is sourced from PubChem (CID 53275224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).