C41H53N3O6 — CID 5327542
tert-butyl N-[(E,2S,3S,5R)-3-hydroxy-5-[[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]carbamoyl]-8-[4-(2-morpholin-4-ylethyl)phenyl]-1-phenyloct-7-en-2-yl]carbamate (PubChem CID 5327542) has the molecular formula C41H53N3O6 and a molecular weight of 683.89 g/mol. Its IUPAC name is tert-butyl N-[(E,2S,3S,5R)-3-hydroxy-5-[[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]carbamoyl]-8-[4-(2-morpholin-4-ylethyl)phenyl]-1-phenyloct-7-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(E,2S,3S,5R)-3-hydroxy-5-[[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]carbamoyl]-8-[4-(2-morpholin-4-ylethyl)phenyl]-1-phenyloct-7-en-2-yl]carbamate |
|---|---|
| PubChem CID | 5327542 |
| Molecular Formula | C41H53N3O6 |
| Molecular Weight | 683.89 g/mol |
| Exact Mass | 683.39 |
| IUPAC Name | tert-butyl N-[(E,2S,3S,5R)-3-hydroxy-5-[[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]carbamoyl]-8-[4-(2-morpholin-4-ylethyl)phenyl]-1-phenyloct-7-en-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccccc1)[C@@H](O)C[C@@H](C/C=C/c1ccc(CCN2CCOCC2)cc1)C(=O)N[C@H]1c2ccccc2C[C@H]1O |
| InChI | InChI=1S/C41H53N3O6/c1-41(2,3)50-40(48)42-35(26-31-10-5-4-6-11-31)36(45)28-33(39(47)43-38-34-15-8-7-13-32(34)27-37(38)46)14-9-12-29-16-18-30(19-17-29)20-21-44-22-24-49-25-23-44/h4-13,15-19,33,35-38,45-46H,14,20-28H2,1-3H3,(H,42,48)(H,43,47)/b12-9+/t33-,35+,36+,37-,38+/m1/s1 |
| InChIKey | JRADSVKTKARKBE-PLZZJPMFSA-N |
| XLogP | 5.24 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.89 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |