About 6-[(3,5-dichlorophenyl)methyl]-5-oxothiomorpholine-3-carboxylic acid
6-[(3,5-dichlorophenyl)methyl]-5-oxothiomorpholine-3-carboxylic acid (PubChem CID 53276035) has the molecular formula C12H11Cl2NO3S
and a molecular weight of 320.20 g/mol. Its IUPAC name is 6-[(3,5-dichlorophenyl)methyl]-5-oxothiomorpholine-3-carboxylic acid.
Molecular Properties
| Compound Name | 6-[(3,5-dichlorophenyl)methyl]-5-oxothiomorpholine-3-carboxylic acid |
| PubChem CID | 53276035 |
| Molecular Formula | C12H11Cl2NO3S |
| Molecular Weight | 320.20 g/mol |
| Exact Mass | 318.98 |
| IUPAC Name | 6-[(3,5-dichlorophenyl)methyl]-5-oxothiomorpholine-3-carboxylic acid |
| SMILES | O=C(O)C1CSC(Cc2cc(Cl)cc(Cl)c2)C(=O)N1 |
| InChI | InChI=1S/C12H11Cl2NO3S/c13-7-1-6(2-8(14)4-7)3-10-11(16)15-9(5-19-10)12(17)18/h1-2,4,9-10H,3,5H2,(H,15,16)(H,17,18) |
| InChIKey | PUPMPBBWPYRJNY-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.20 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-[(3,5-dichlorophenyl)methyl]-5-oxothiomorpholine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(3,5-dichlorophenyl)methyl]-5-oxothiomorpholine-3-carboxylic acid?
The IUPAC name of 6-[(3,5-dichlorophenyl)methyl]-5-oxothiomorpholine-3-carboxylic acid (CID 53276035) is 6-[(3,5-dichlorophenyl)methyl]-5-oxothiomorpholine-3-carboxylic acid.
What is the SMILES notation for 6-[(3,5-dichlorophenyl)methyl]-5-oxothiomorpholine-3-carboxylic acid?
The canonical SMILES for 6-[(3,5-dichlorophenyl)methyl]-5-oxothiomorpholine-3-carboxylic acid is O=C(O)C1CSC(Cc2cc(Cl)cc(Cl)c2)C(=O)N1.
What is the InChIKey of 6-[(3,5-dichlorophenyl)methyl]-5-oxothiomorpholine-3-carboxylic acid?
The InChIKey is PUPMPBBWPYRJNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11Cl2NO3S/c13-7-1-6(2-8(14)4-7)3-10-11(16)15-9(5-19-10)12(17)18/h1-2,4,9-10H,3,5H2,(H,15,16)(H,17,18).
What are the key properties of 6-[(3,5-dichlorophenyl)methyl]-5-oxothiomorpholine-3-carboxylic acid?
6-[(3,5-dichlorophenyl)methyl]-5-oxothiomorpholine-3-carboxylic acid has a molecular weight of 320.20 g/mol, XLogP of 2.22, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(3,5-dichlorophenyl)methyl]-5-oxothiomorpholine-3-carboxylic acid is sourced from PubChem (CID 53276035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).