C22H20N4O — CID 5327624
2-ethyl-9-methyl-13-[(Z)-2-phenylethenyl]-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-10-one (PubChem CID 5327624) has the molecular formula C22H20N4O and a molecular weight of 356.43 g/mol. Its IUPAC name is 2-ethyl-9-methyl-13-[(Z)-2-phenylethenyl]-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-10-one.
| Compound Name | 2-ethyl-9-methyl-13-[(Z)-2-phenylethenyl]-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-10-one |
|---|---|
| PubChem CID | 5327624 |
| Molecular Formula | C22H20N4O |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 2-ethyl-9-methyl-13-[(Z)-2-phenylethenyl]-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-10-one |
| SMILES | CCN1c2ncc(/C=C\c3ccccc3)cc2C(=O)N(C)c2cccnc21 |
| InChI | InChI=1S/C22H20N4O/c1-3-26-20-18(22(27)25(2)19-10-7-13-23-21(19)26)14-17(15-24-20)12-11-16-8-5-4-6-9-16/h4-15H,3H2,1-2H3/b12-11- |
| InChIKey | AJCZKSKCXVCTMF-QXMHVHEDSA-N |
| XLogP | 4.39 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |