About 1-amino-2-(3,4-dimethylphenyl)cyclopropane-1-carboxylic acid
1-amino-2-(3,4-dimethylphenyl)cyclopropane-1-carboxylic acid (PubChem CID 53276282) has the molecular formula C12H15NO2
and a molecular weight of 205.26 g/mol. Its IUPAC name is 1-amino-2-(3,4-dimethylphenyl)cyclopropane-1-carboxylic acid.
Analyze 1-amino-2-(3,4-dimethylphenyl)cyclopropane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-2-(3,4-dimethylphenyl)cyclopropane-1-carboxylic acid?
The IUPAC name of 1-amino-2-(3,4-dimethylphenyl)cyclopropane-1-carboxylic acid (CID 53276282) is 1-amino-2-(3,4-dimethylphenyl)cyclopropane-1-carboxylic acid.
What is the SMILES notation for 1-amino-2-(3,4-dimethylphenyl)cyclopropane-1-carboxylic acid?
The canonical SMILES for 1-amino-2-(3,4-dimethylphenyl)cyclopropane-1-carboxylic acid is Cc1ccc(C2CC2(N)C(=O)O)cc1C.
What is the InChIKey of 1-amino-2-(3,4-dimethylphenyl)cyclopropane-1-carboxylic acid?
The InChIKey is FWNMNSGLTGJTAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO2/c1-7-3-4-9(5-8(7)2)10-6-12(10,13)11(14)15/h3-5,10H,6,13H2,1-2H3,(H,14,15).
What are the key properties of 1-amino-2-(3,4-dimethylphenyl)cyclopropane-1-carboxylic acid?
1-amino-2-(3,4-dimethylphenyl)cyclopropane-1-carboxylic acid has a molecular weight of 205.26 g/mol, XLogP of 1.57, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-2-(3,4-dimethylphenyl)cyclopropane-1-carboxylic acid is sourced from PubChem (CID 53276282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).