About 3-(3-aminophenyl)-4-(1-methylindol-3-yl)pyrrole-2,5-dione
3-(3-aminophenyl)-4-(1-methylindol-3-yl)pyrrole-2,5-dione (PubChem CID 5327711) has the molecular formula C19H15N3O2
and a molecular weight of 317.35 g/mol. Its IUPAC name is 3-(3-aminophenyl)-4-(1-methylindol-3-yl)pyrrole-2,5-dione.
Molecular Properties
| Compound Name | 3-(3-aminophenyl)-4-(1-methylindol-3-yl)pyrrole-2,5-dione |
| PubChem CID | 5327711 |
| Molecular Formula | C19H15N3O2 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 3-(3-aminophenyl)-4-(1-methylindol-3-yl)pyrrole-2,5-dione |
| SMILES | Cn1cc(C2=C(c3cccc(N)c3)C(=O)NC2=O)c2ccccc21 |
| InChI | InChI=1S/C19H15N3O2/c1-22-10-14(13-7-2-3-8-15(13)22)17-16(18(23)21-19(17)24)11-5-4-6-12(20)9-11/h2-10H,20H2,1H3,(H,21,23,24) |
| InChIKey | RGTAEYDIDMGJLX-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-aminophenyl)-4-(1-methylindol-3-yl)pyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-aminophenyl)-4-(1-methylindol-3-yl)pyrrole-2,5-dione?
The IUPAC name of 3-(3-aminophenyl)-4-(1-methylindol-3-yl)pyrrole-2,5-dione (CID 5327711) is 3-(3-aminophenyl)-4-(1-methylindol-3-yl)pyrrole-2,5-dione.
What is the SMILES notation for 3-(3-aminophenyl)-4-(1-methylindol-3-yl)pyrrole-2,5-dione?
The canonical SMILES for 3-(3-aminophenyl)-4-(1-methylindol-3-yl)pyrrole-2,5-dione is Cn1cc(C2=C(c3cccc(N)c3)C(=O)NC2=O)c2ccccc21.
What is the InChIKey of 3-(3-aminophenyl)-4-(1-methylindol-3-yl)pyrrole-2,5-dione?
The InChIKey is RGTAEYDIDMGJLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15N3O2/c1-22-10-14(13-7-2-3-8-15(13)22)17-16(18(23)21-19(17)24)11-5-4-6-12(20)9-11/h2-10H,20H2,1H3,(H,21,23,24).
What are the key properties of 3-(3-aminophenyl)-4-(1-methylindol-3-yl)pyrrole-2,5-dione?
3-(3-aminophenyl)-4-(1-methylindol-3-yl)pyrrole-2,5-dione has a molecular weight of 317.35 g/mol, XLogP of 2.33, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-aminophenyl)-4-(1-methylindol-3-yl)pyrrole-2,5-dione is sourced from PubChem (CID 5327711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).