C19H11Cl3N2O2 — CID 5327722
3-(1-methylindol-3-yl)-4-(2,3,6-trichlorophenyl)pyrrole-2,5-dione (PubChem CID 5327722) has the molecular formula C19H11Cl3N2O2 and a molecular weight of 405.67 g/mol. Its IUPAC name is 3-(1-methylindol-3-yl)-4-(2,3,6-trichlorophenyl)pyrrole-2,5-dione.
| Compound Name | 3-(1-methylindol-3-yl)-4-(2,3,6-trichlorophenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 5327722 |
| Molecular Formula | C19H11Cl3N2O2 |
| Molecular Weight | 405.67 g/mol |
| Exact Mass | 403.99 |
| IUPAC Name | 3-(1-methylindol-3-yl)-4-(2,3,6-trichlorophenyl)pyrrole-2,5-dione |
| SMILES | Cn1cc(C2=C(c3c(Cl)ccc(Cl)c3Cl)C(=O)NC2=O)c2ccccc21 |
| InChI | InChI=1S/C19H11Cl3N2O2/c1-24-8-10(9-4-2-3-5-13(9)24)14-16(19(26)23-18(14)25)15-11(20)6-7-12(21)17(15)22/h2-8H,1H3,(H,23,25,26) |
| InChIKey | OZJHCSVHKOBCRK-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.67 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|