About 3-(1H-indol-3-yl)-4-[1-[(1-methylpiperidin-3-yl)methyl]indol-3-yl]pyrrole-2,5-dione
3-(1H-indol-3-yl)-4-[1-[(1-methylpiperidin-3-yl)methyl]indol-3-yl]pyrrole-2,5-dione (PubChem CID 5327733) has the molecular formula C27H26N4O2
and a molecular weight of 438.53 g/mol. Its IUPAC name is 3-(1H-indol-3-yl)-4-[1-[(1-methylpiperidin-3-yl)methyl]indol-3-yl]pyrrole-2,5-dione.
Molecular Properties
| Compound Name | 3-(1H-indol-3-yl)-4-[1-[(1-methylpiperidin-3-yl)methyl]indol-3-yl]pyrrole-2,5-dione |
| PubChem CID | 5327733 |
| Molecular Formula | C27H26N4O2 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | 3-(1H-indol-3-yl)-4-[1-[(1-methylpiperidin-3-yl)methyl]indol-3-yl]pyrrole-2,5-dione |
| SMILES | CN1CCCC(Cn2cc(C3=C(c4c[nH]c5ccccc45)C(=O)NC3=O)c3ccccc32)C1 |
| InChI | InChI=1S/C27H26N4O2/c1-30-12-6-7-17(14-30)15-31-16-21(19-9-3-5-11-23(19)31)25-24(26(32)29-27(25)33)20-13-28-22-10-4-2-8-18(20)22/h2-5,8-11,13,16-17,28H,6-7,12,14-15H2,1H3,(H,29,32,33) |
| InChIKey | HBSZWHXBVARXJV-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 70.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-(1H-indol-3-yl)-4-[1-[(1-methylpiperidin-3-yl)methyl]indol-3-yl]pyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1H-indol-3-yl)-4-[1-[(1-methylpiperidin-3-yl)methyl]indol-3-yl]pyrrole-2,5-dione?
The IUPAC name of 3-(1H-indol-3-yl)-4-[1-[(1-methylpiperidin-3-yl)methyl]indol-3-yl]pyrrole-2,5-dione (CID 5327733) is 3-(1H-indol-3-yl)-4-[1-[(1-methylpiperidin-3-yl)methyl]indol-3-yl]pyrrole-2,5-dione.
What is the SMILES notation for 3-(1H-indol-3-yl)-4-[1-[(1-methylpiperidin-3-yl)methyl]indol-3-yl]pyrrole-2,5-dione?
The canonical SMILES for 3-(1H-indol-3-yl)-4-[1-[(1-methylpiperidin-3-yl)methyl]indol-3-yl]pyrrole-2,5-dione is CN1CCCC(Cn2cc(C3=C(c4c[nH]c5ccccc45)C(=O)NC3=O)c3ccccc32)C1.
What is the InChIKey of 3-(1H-indol-3-yl)-4-[1-[(1-methylpiperidin-3-yl)methyl]indol-3-yl]pyrrole-2,5-dione?
The InChIKey is HBSZWHXBVARXJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H26N4O2/c1-30-12-6-7-17(14-30)15-31-16-21(19-9-3-5-11-23(19)31)25-24(26(32)29-27(25)33)20-13-28-22-10-4-2-8-18(20)22/h2-5,8-11,13,16-17,28H,6-7,12,14-15H2,1H3,(H,29,32,33).
What are the key properties of 3-(1H-indol-3-yl)-4-[1-[(1-methylpiperidin-3-yl)methyl]indol-3-yl]pyrrole-2,5-dione?
3-(1H-indol-3-yl)-4-[1-[(1-methylpiperidin-3-yl)methyl]indol-3-yl]pyrrole-2,5-dione has a molecular weight of 438.53 g/mol, XLogP of 4.03, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1H-indol-3-yl)-4-[1-[(1-methylpiperidin-3-yl)methyl]indol-3-yl]pyrrole-2,5-dione is sourced from PubChem (CID 5327733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).