C25H21N3O2 — CID 5327736
3-(1-methylindol-3-yl)-4-(6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl)pyrrole-2,5-dione (PubChem CID 5327736) has the molecular formula C25H21N3O2 and a molecular weight of 395.46 g/mol. Its IUPAC name is 3-(1-methylindol-3-yl)-4-(6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl)pyrrole-2,5-dione.
| Compound Name | 3-(1-methylindol-3-yl)-4-(6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 5327736 |
| Molecular Formula | C25H21N3O2 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 3-(1-methylindol-3-yl)-4-(6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl)pyrrole-2,5-dione |
| SMILES | Cn1cc(C2=C(c3c4n(c5ccccc35)CCCC4)C(=O)NC2=O)c2ccccc21 |
| InChI | InChI=1S/C25H21N3O2/c1-27-14-17(15-8-2-4-10-18(15)27)22-23(25(30)26-24(22)29)21-16-9-3-5-11-19(16)28-13-7-6-12-20(21)28/h2-5,8-11,14H,6-7,12-13H2,1H3,(H,26,29,30) |
| InChIKey | VPTSHTDSHSZINV-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 56.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|