C25H22N4O2 — CID 5327746
3-(7-amino-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl)-4-(1-methylindol-3-yl)pyrrole-2,5-dione (PubChem CID 5327746) has the molecular formula C25H22N4O2 and a molecular weight of 410.48 g/mol. Its IUPAC name is 3-(7-amino-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl)-4-(1-methylindol-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-(7-amino-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl)-4-(1-methylindol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 5327746 |
| Molecular Formula | C25H22N4O2 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 3-(7-amino-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl)-4-(1-methylindol-3-yl)pyrrole-2,5-dione |
| SMILES | Cn1cc(C2=C(c3c4n(c5ccccc35)CC(N)CC4)C(=O)NC2=O)c2ccccc21 |
| InChI | InChI=1S/C25H22N4O2/c1-28-13-17(15-6-2-4-8-18(15)28)22-23(25(31)27-24(22)30)21-16-7-3-5-9-19(16)29-12-14(26)10-11-20(21)29/h2-9,13-14H,10-12,26H2,1H3,(H,27,30,31) |
| InChIKey | MJXTZIXADVKTDA-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|