About ethyl 7-nitro-5-oxo-2,3-dihydro-1H-imidazo[1,2-b]isoquinoline-10-carboxylate
ethyl 7-nitro-5-oxo-2,3-dihydro-1H-imidazo[1,2-b]isoquinoline-10-carboxylate (PubChem CID 53277863) has the molecular formula C14H13N3O5
and a molecular weight of 303.27 g/mol. Its IUPAC name is ethyl 7-nitro-5-oxo-2,3-dihydro-1H-imidazo[1,2-b]isoquinoline-10-carboxylate.
Molecular Properties
| Compound Name | ethyl 7-nitro-5-oxo-2,3-dihydro-1H-imidazo[1,2-b]isoquinoline-10-carboxylate |
| PubChem CID | 53277863 |
| Molecular Formula | C14H13N3O5 |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | ethyl 7-nitro-5-oxo-2,3-dihydro-1H-imidazo[1,2-b]isoquinoline-10-carboxylate |
| SMILES | CCOC(=O)c1c2n(c(=O)c3cc([N+](=O)[O-])ccc13)CCN2 |
| InChI | InChI=1S/C14H13N3O5/c1-2-22-14(19)11-9-4-3-8(17(20)21)7-10(9)13(18)16-6-5-15-12(11)16/h3-4,7,15H,2,5-6H2,1H3 |
| InChIKey | DUFIHBLPZULAQA-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 103.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 7-nitro-5-oxo-2,3-dihydro-1H-imidazo[1,2-b]isoquinoline-10-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 7-nitro-5-oxo-2,3-dihydro-1H-imidazo[1,2-b]isoquinoline-10-carboxylate?
The IUPAC name of ethyl 7-nitro-5-oxo-2,3-dihydro-1H-imidazo[1,2-b]isoquinoline-10-carboxylate (CID 53277863) is ethyl 7-nitro-5-oxo-2,3-dihydro-1H-imidazo[1,2-b]isoquinoline-10-carboxylate.
What is the SMILES notation for ethyl 7-nitro-5-oxo-2,3-dihydro-1H-imidazo[1,2-b]isoquinoline-10-carboxylate?
The canonical SMILES for ethyl 7-nitro-5-oxo-2,3-dihydro-1H-imidazo[1,2-b]isoquinoline-10-carboxylate is CCOC(=O)c1c2n(c(=O)c3cc([N+](=O)[O-])ccc13)CCN2.
What is the InChIKey of ethyl 7-nitro-5-oxo-2,3-dihydro-1H-imidazo[1,2-b]isoquinoline-10-carboxylate?
The InChIKey is DUFIHBLPZULAQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N3O5/c1-2-22-14(19)11-9-4-3-8(17(20)21)7-10(9)13(18)16-6-5-15-12(11)16/h3-4,7,15H,2,5-6H2,1H3.
What are the key properties of ethyl 7-nitro-5-oxo-2,3-dihydro-1H-imidazo[1,2-b]isoquinoline-10-carboxylate?
ethyl 7-nitro-5-oxo-2,3-dihydro-1H-imidazo[1,2-b]isoquinoline-10-carboxylate has a molecular weight of 303.27 g/mol, XLogP of 1.51, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 7-nitro-5-oxo-2,3-dihydro-1H-imidazo[1,2-b]isoquinoline-10-carboxylate is sourced from PubChem (CID 53277863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).