About 3-N-(3-chlorophenyl)-4-N-phenyl-2H-pyrazolo[3,4-d]pyrimidine-3,4-diamine
3-N-(3-chlorophenyl)-4-N-phenyl-2H-pyrazolo[3,4-d]pyrimidine-3,4-diamine (PubChem CID 5327824) has the molecular formula C17H13ClN6
and a molecular weight of 336.79 g/mol. Its IUPAC name is 3-N-(3-chlorophenyl)-4-N-phenyl-2H-pyrazolo[3,4-d]pyrimidine-3,4-diamine.
Molecular Properties
| Compound Name | 3-N-(3-chlorophenyl)-4-N-phenyl-2H-pyrazolo[3,4-d]pyrimidine-3,4-diamine |
| PubChem CID | 5327824 |
| Molecular Formula | C17H13ClN6 |
| Molecular Weight | 336.79 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 3-N-(3-chlorophenyl)-4-N-phenyl-2H-pyrazolo[3,4-d]pyrimidine-3,4-diamine |
| SMILES | Clc1cccc(Nc2[nH]nc3ncnc(Nc4ccccc4)c23)c1 |
| InChI | InChI=1S/C17H13ClN6/c18-11-5-4-8-13(9-11)22-17-14-15(19-10-20-16(14)23-24-17)21-12-6-2-1-3-7-12/h1-10H,(H3,19,20,21,22,23,24) |
| InChIKey | XCZCKVIRXXMKJC-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.79 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-N-(3-chlorophenyl)-4-N-phenyl-2H-pyrazolo[3,4-d]pyrimidine-3,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-(3-chlorophenyl)-4-N-phenyl-2H-pyrazolo[3,4-d]pyrimidine-3,4-diamine?
The IUPAC name of 3-N-(3-chlorophenyl)-4-N-phenyl-2H-pyrazolo[3,4-d]pyrimidine-3,4-diamine (CID 5327824) is 3-N-(3-chlorophenyl)-4-N-phenyl-2H-pyrazolo[3,4-d]pyrimidine-3,4-diamine.
What is the SMILES notation for 3-N-(3-chlorophenyl)-4-N-phenyl-2H-pyrazolo[3,4-d]pyrimidine-3,4-diamine?
The canonical SMILES for 3-N-(3-chlorophenyl)-4-N-phenyl-2H-pyrazolo[3,4-d]pyrimidine-3,4-diamine is Clc1cccc(Nc2[nH]nc3ncnc(Nc4ccccc4)c23)c1.
What is the InChIKey of 3-N-(3-chlorophenyl)-4-N-phenyl-2H-pyrazolo[3,4-d]pyrimidine-3,4-diamine?
The InChIKey is XCZCKVIRXXMKJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13ClN6/c18-11-5-4-8-13(9-11)22-17-14-15(19-10-20-16(14)23-24-17)21-12-6-2-1-3-7-12/h1-10H,(H3,19,20,21,22,23,24).
What are the key properties of 3-N-(3-chlorophenyl)-4-N-phenyl-2H-pyrazolo[3,4-d]pyrimidine-3,4-diamine?
3-N-(3-chlorophenyl)-4-N-phenyl-2H-pyrazolo[3,4-d]pyrimidine-3,4-diamine has a molecular weight of 336.79 g/mol, XLogP of 4.49, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-(3-chlorophenyl)-4-N-phenyl-2H-pyrazolo[3,4-d]pyrimidine-3,4-diamine is sourced from PubChem (CID 5327824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).