C19H18ClN7 — CID 5327834
4-N-(3-chlorophenyl)-3-N-[4-(dimethylamino)phenyl]-2H-pyrazolo[3,4-d]pyrimidine-3,4-diamine (PubChem CID 5327834) has the molecular formula C19H18ClN7 and a molecular weight of 379.86 g/mol. Its IUPAC name is 4-N-(3-chlorophenyl)-3-N-[4-(dimethylamino)phenyl]-2H-pyrazolo[3,4-d]pyrimidine-3,4-diamine.
| Compound Name | 4-N-(3-chlorophenyl)-3-N-[4-(dimethylamino)phenyl]-2H-pyrazolo[3,4-d]pyrimidine-3,4-diamine |
|---|---|
| PubChem CID | 5327834 |
| Molecular Formula | C19H18ClN7 |
| Molecular Weight | 379.86 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | 4-N-(3-chlorophenyl)-3-N-[4-(dimethylamino)phenyl]-2H-pyrazolo[3,4-d]pyrimidine-3,4-diamine |
| SMILES | CN(C)c1ccc(Nc2[nH]nc3ncnc(Nc4cccc(Cl)c4)c23)cc1 |
| InChI | InChI=1S/C19H18ClN7/c1-27(2)15-8-6-13(7-9-15)23-19-16-17(21-11-22-18(16)25-26-19)24-14-5-3-4-12(20)10-14/h3-11H,1-2H3,(H3,21,22,23,24,25,26) |
| InChIKey | DBMNQXNYFIEZLF-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 81.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.86 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|