C26H26N4O — CID 5327854
23-[3-(dimethylamino)propyl]-3-methyl-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaen-12-one (PubChem CID 5327854) has the molecular formula C26H26N4O and a molecular weight of 410.52 g/mol. Its IUPAC name is 23-[3-(dimethylamino)propyl]-3-methyl-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaen-12-one.
| Compound Name | 23-[3-(dimethylamino)propyl]-3-methyl-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaen-12-one |
|---|---|
| PubChem CID | 5327854 |
| Molecular Formula | C26H26N4O |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | 23-[3-(dimethylamino)propyl]-3-methyl-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaen-12-one |
| SMILES | CN(C)CCCn1c2ccccc2c2c3c(c4c5ccccc5n(C)c4c21)C(=O)NC3 |
| InChI | InChI=1S/C26H26N4O/c1-28(2)13-8-14-30-20-12-7-5-10-17(20)21-18-15-27-26(31)23(18)22-16-9-4-6-11-19(16)29(3)24(22)25(21)30/h4-7,9-12H,8,13-15H2,1-3H3,(H,27,31) |
| InChIKey | HACWJRNIFJVYCL-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 42.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |