C18H18Cl2N4O — CID 5327871
2-(butylamino)-6-(2,6-dichlorophenyl)-8-methylpyrido[2,3-d]pyrimidin-7-one (PubChem CID 5327871) has the molecular formula C18H18Cl2N4O and a molecular weight of 377.28 g/mol. Its IUPAC name is 2-(butylamino)-6-(2,6-dichlorophenyl)-8-methylpyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2-(butylamino)-6-(2,6-dichlorophenyl)-8-methylpyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 5327871 |
| Molecular Formula | C18H18Cl2N4O |
| Molecular Weight | 377.28 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 2-(butylamino)-6-(2,6-dichlorophenyl)-8-methylpyrido[2,3-d]pyrimidin-7-one |
| SMILES | CCCCNc1ncc2cc(-c3c(Cl)cccc3Cl)c(=O)n(C)c2n1 |
| InChI | InChI=1S/C18H18Cl2N4O/c1-3-4-8-21-18-22-10-11-9-12(17(25)24(2)16(11)23-18)15-13(19)6-5-7-14(15)20/h5-7,9-10H,3-4,8H2,1-2H3,(H,21,22,23) |
| InChIKey | QOSLUZXSYUGPOU-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.28 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|