C21H25Cl2N5O — CID 5327876
6-(2,6-dichlorophenyl)-2-[3-(diethylamino)propylamino]-8-methylpyrido[2,3-d]pyrimidin-7-one (PubChem CID 5327876) has the molecular formula C21H25Cl2N5O and a molecular weight of 434.37 g/mol. Its IUPAC name is 6-(2,6-dichlorophenyl)-2-[3-(diethylamino)propylamino]-8-methylpyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 6-(2,6-dichlorophenyl)-2-[3-(diethylamino)propylamino]-8-methylpyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 5327876 |
| Molecular Formula | C21H25Cl2N5O |
| Molecular Weight | 434.37 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | 6-(2,6-dichlorophenyl)-2-[3-(diethylamino)propylamino]-8-methylpyrido[2,3-d]pyrimidin-7-one |
| SMILES | CCN(CC)CCCNc1ncc2cc(-c3c(Cl)cccc3Cl)c(=O)n(C)c2n1 |
| InChI | InChI=1S/C21H25Cl2N5O/c1-4-28(5-2)11-7-10-24-21-25-13-14-12-15(20(29)27(3)19(14)26-21)18-16(22)8-6-9-17(18)23/h6,8-9,12-13H,4-5,7,10-11H2,1-3H3,(H,24,25,26) |
| InChIKey | NZHAVEPSCYGCPU-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.37 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|