C22H26Cl2N6O — CID 5327878
6-(2,6-dichlorophenyl)-8-methyl-2-[3-(4-methylpiperazin-1-yl)propylamino]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 5327878) has the molecular formula C22H26Cl2N6O and a molecular weight of 461.40 g/mol. Its IUPAC name is 6-(2,6-dichlorophenyl)-8-methyl-2-[3-(4-methylpiperazin-1-yl)propylamino]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 6-(2,6-dichlorophenyl)-8-methyl-2-[3-(4-methylpiperazin-1-yl)propylamino]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 5327878 |
| Molecular Formula | C22H26Cl2N6O |
| Molecular Weight | 461.40 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | 6-(2,6-dichlorophenyl)-8-methyl-2-[3-(4-methylpiperazin-1-yl)propylamino]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | CN1CCN(CCCNc2ncc3cc(-c4c(Cl)cccc4Cl)c(=O)n(C)c3n2)CC1 |
| InChI | InChI=1S/C22H26Cl2N6O/c1-28-9-11-30(12-10-28)8-4-7-25-22-26-14-15-13-16(21(31)29(2)20(15)27-22)19-17(23)5-3-6-18(19)24/h3,5-6,13-14H,4,7-12H2,1-2H3,(H,25,26,27) |
| InChIKey | NZUXTCRYWPXTJA-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|