C24H30Cl2N6O — CID 5327880
6-(2,6-dichlorophenyl)-8-methyl-2-[5-(4-methylpiperazin-1-yl)pentylamino]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 5327880) has the molecular formula C24H30Cl2N6O and a molecular weight of 489.45 g/mol. Its IUPAC name is 6-(2,6-dichlorophenyl)-8-methyl-2-[5-(4-methylpiperazin-1-yl)pentylamino]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 6-(2,6-dichlorophenyl)-8-methyl-2-[5-(4-methylpiperazin-1-yl)pentylamino]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 5327880 |
| Molecular Formula | C24H30Cl2N6O |
| Molecular Weight | 489.45 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | 6-(2,6-dichlorophenyl)-8-methyl-2-[5-(4-methylpiperazin-1-yl)pentylamino]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | CN1CCN(CCCCCNc2ncc3cc(-c4c(Cl)cccc4Cl)c(=O)n(C)c3n2)CC1 |
| InChI | InChI=1S/C24H30Cl2N6O/c1-30-11-13-32(14-12-30)10-5-3-4-9-27-24-28-16-17-15-18(23(33)31(2)22(17)29-24)21-19(25)7-6-8-20(21)26/h6-8,15-16H,3-5,9-14H2,1-2H3,(H,27,28,29) |
| InChIKey | NMLMUNQQEDDASM-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.45 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|