About 6-(2,6-dichlorophenyl)-2-(2-methoxyanilino)-8-methylpyrido[2,3-d]pyrimidin-7-one
6-(2,6-dichlorophenyl)-2-(2-methoxyanilino)-8-methylpyrido[2,3-d]pyrimidin-7-one (PubChem CID 5327894) has the molecular formula C21H16Cl2N4O2
and a molecular weight of 427.29 g/mol. Its IUPAC name is 6-(2,6-dichlorophenyl)-2-(2-methoxyanilino)-8-methylpyrido[2,3-d]pyrimidin-7-one.
Molecular Properties
| Compound Name | 6-(2,6-dichlorophenyl)-2-(2-methoxyanilino)-8-methylpyrido[2,3-d]pyrimidin-7-one |
| PubChem CID | 5327894 |
| Molecular Formula | C21H16Cl2N4O2 |
| Molecular Weight | 427.29 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | 6-(2,6-dichlorophenyl)-2-(2-methoxyanilino)-8-methylpyrido[2,3-d]pyrimidin-7-one |
| SMILES | COc1ccccc1Nc1ncc2cc(-c3c(Cl)cccc3Cl)c(=O)n(C)c2n1 |
| InChI | InChI=1S/C21H16Cl2N4O2/c1-27-19-12(10-13(20(27)28)18-14(22)6-5-7-15(18)23)11-24-21(26-19)25-16-8-3-4-9-17(16)29-2/h3-11H,1-2H3,(H,24,25,26) |
| InChIKey | FCUQJIQLHXSQHY-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 427.29 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-(2,6-dichlorophenyl)-2-(2-methoxyanilino)-8-methylpyrido[2,3-d]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,6-dichlorophenyl)-2-(2-methoxyanilino)-8-methylpyrido[2,3-d]pyrimidin-7-one?
The IUPAC name of 6-(2,6-dichlorophenyl)-2-(2-methoxyanilino)-8-methylpyrido[2,3-d]pyrimidin-7-one (CID 5327894) is 6-(2,6-dichlorophenyl)-2-(2-methoxyanilino)-8-methylpyrido[2,3-d]pyrimidin-7-one.
What is the SMILES notation for 6-(2,6-dichlorophenyl)-2-(2-methoxyanilino)-8-methylpyrido[2,3-d]pyrimidin-7-one?
The canonical SMILES for 6-(2,6-dichlorophenyl)-2-(2-methoxyanilino)-8-methylpyrido[2,3-d]pyrimidin-7-one is COc1ccccc1Nc1ncc2cc(-c3c(Cl)cccc3Cl)c(=O)n(C)c2n1.
What is the InChIKey of 6-(2,6-dichlorophenyl)-2-(2-methoxyanilino)-8-methylpyrido[2,3-d]pyrimidin-7-one?
The InChIKey is FCUQJIQLHXSQHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16Cl2N4O2/c1-27-19-12(10-13(20(27)28)18-14(22)6-5-7-15(18)23)11-24-21(26-19)25-16-8-3-4-9-17(16)29-2/h3-11H,1-2H3,(H,24,25,26).
What are the key properties of 6-(2,6-dichlorophenyl)-2-(2-methoxyanilino)-8-methylpyrido[2,3-d]pyrimidin-7-one?
6-(2,6-dichlorophenyl)-2-(2-methoxyanilino)-8-methylpyrido[2,3-d]pyrimidin-7-one has a molecular weight of 427.29 g/mol, XLogP of 5.05, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,6-dichlorophenyl)-2-(2-methoxyanilino)-8-methylpyrido[2,3-d]pyrimidin-7-one is sourced from PubChem (CID 5327894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).