C19H23ClN2O4S — CID 53279028
2-[N-(benzenesulfonyl)-3-chloro-4-methoxyanilino]-N-butylacetamide (PubChem CID 53279028) has the molecular formula C19H23ClN2O4S and a molecular weight of 410.92 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-3-chloro-4-methoxyanilino]-N-butylacetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-3-chloro-4-methoxyanilino]-N-butylacetamide |
|---|---|
| PubChem CID | 53279028 |
| Molecular Formula | C19H23ClN2O4S |
| Molecular Weight | 410.92 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-3-chloro-4-methoxyanilino]-N-butylacetamide |
| SMILES | CCCCNC(=O)CN(c1ccc(OC)c(Cl)c1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H23ClN2O4S/c1-3-4-12-21-19(23)14-22(15-10-11-18(26-2)17(20)13-15)27(24,25)16-8-6-5-7-9-16/h5-11,13H,3-4,12,14H2,1-2H3,(H,21,23) |
| InChIKey | PKOFBSCJVMRAIO-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.92 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|