C25H25Cl2N5O2 — CID 5327907
6-(2,6-dichlorophenyl)-2-[4-[3-(dimethylamino)propoxy]anilino]-8-methylpyrido[2,3-d]pyrimidin-7-one (PubChem CID 5327907) has the molecular formula C25H25Cl2N5O2 and a molecular weight of 498.41 g/mol. Its IUPAC name is 6-(2,6-dichlorophenyl)-2-[4-[3-(dimethylamino)propoxy]anilino]-8-methylpyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 6-(2,6-dichlorophenyl)-2-[4-[3-(dimethylamino)propoxy]anilino]-8-methylpyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 5327907 |
| Molecular Formula | C25H25Cl2N5O2 |
| Molecular Weight | 498.41 g/mol |
| Exact Mass | 497.14 |
| IUPAC Name | 6-(2,6-dichlorophenyl)-2-[4-[3-(dimethylamino)propoxy]anilino]-8-methylpyrido[2,3-d]pyrimidin-7-one |
| SMILES | CN(C)CCCOc1ccc(Nc2ncc3cc(-c4c(Cl)cccc4Cl)c(=O)n(C)c3n2)cc1 |
| InChI | InChI=1S/C25H25Cl2N5O2/c1-31(2)12-5-13-34-18-10-8-17(9-11-18)29-25-28-15-16-14-19(24(33)32(3)23(16)30-25)22-20(26)6-4-7-21(22)27/h4,6-11,14-15H,5,12-13H2,1-3H3,(H,28,29,30) |
| InChIKey | KSCDJRWPBJOREH-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.41 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|