C27H30Cl2N5O2+ — CID 5327911
2-[4-[[6-(2,6-dichlorophenyl)-8-methyl-7-oxopyrido[2,3-d]pyrimidin-2-yl]amino]phenoxy]ethyl-diethyl-methylazanium (PubChem CID 5327911) has the molecular formula C27H30Cl2N5O2+ and a molecular weight of 527.48 g/mol. Its IUPAC name is 2-[4-[[6-(2,6-dichlorophenyl)-8-methyl-7-oxopyrido[2,3-d]pyrimidin-2-yl]amino]phenoxy]ethyl-diethyl-methylazanium.
| Compound Name | 2-[4-[[6-(2,6-dichlorophenyl)-8-methyl-7-oxopyrido[2,3-d]pyrimidin-2-yl]amino]phenoxy]ethyl-diethyl-methylazanium |
|---|---|
| PubChem CID | 5327911 |
| Molecular Formula | C27H30Cl2N5O2+ |
| Molecular Weight | 527.48 g/mol |
| Exact Mass | 526.18 |
| IUPAC Name | 2-[4-[[6-(2,6-dichlorophenyl)-8-methyl-7-oxopyrido[2,3-d]pyrimidin-2-yl]amino]phenoxy]ethyl-diethyl-methylazanium |
| SMILES | CC[N+](C)(CC)CCOc1ccc(Nc2ncc3cc(-c4c(Cl)cccc4Cl)c(=O)n(C)c3n2)cc1 |
| InChI | InChI=1S/C27H29Cl2N5O2/c1-5-34(4,6-2)14-15-36-20-12-10-19(11-13-20)31-27-30-17-18-16-21(26(35)33(3)25(18)32-27)24-22(28)8-7-9-23(24)29/h7-13,16-17H,5-6,14-15H2,1-4H3/p+1 |
| InChIKey | PKKMIHJGXZABIL-UHFFFAOYSA-O |
| XLogP | 5.91 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.48 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|