C28H34N4O5S — CID 53279448
2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-methylanilino)-N-[4-(4-methylpiperazin-1-yl)phenyl]acetamide (PubChem CID 53279448) has the molecular formula C28H34N4O5S and a molecular weight of 538.67 g/mol. Its IUPAC name is 2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-methylanilino)-N-[4-(4-methylpiperazin-1-yl)phenyl]acetamide.
| Compound Name | 2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-methylanilino)-N-[4-(4-methylpiperazin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 53279448 |
| Molecular Formula | C28H34N4O5S |
| Molecular Weight | 538.67 g/mol |
| Exact Mass | 538.22 |
| IUPAC Name | 2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-methylanilino)-N-[4-(4-methylpiperazin-1-yl)phenyl]acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)Nc2ccc(N3CCN(C)CC3)cc2)c2ccc(C)cc2)cc1OC |
| InChI | InChI=1S/C28H34N4O5S/c1-21-5-9-24(10-6-21)32(38(34,35)25-13-14-26(36-3)27(19-25)37-4)20-28(33)29-22-7-11-23(12-8-22)31-17-15-30(2)16-18-31/h5-14,19H,15-18,20H2,1-4H3,(H,29,33) |
| InChIKey | KWEFYMAJFYEPHR-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.67 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|