C21H29N5O3S — CID 53280050
2-[N-(dimethylsulfamoyl)anilino]-N-[4-(4-methylpiperazin-1-yl)phenyl]acetamide (PubChem CID 53280050) has the molecular formula C21H29N5O3S and a molecular weight of 431.56 g/mol. Its IUPAC name is 2-[N-(dimethylsulfamoyl)anilino]-N-[4-(4-methylpiperazin-1-yl)phenyl]acetamide.
| Compound Name | 2-[N-(dimethylsulfamoyl)anilino]-N-[4-(4-methylpiperazin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 53280050 |
| Molecular Formula | C21H29N5O3S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | 2-[N-(dimethylsulfamoyl)anilino]-N-[4-(4-methylpiperazin-1-yl)phenyl]acetamide |
| SMILES | CN1CCN(c2ccc(NC(=O)CN(c3ccccc3)S(=O)(=O)N(C)C)cc2)CC1 |
| InChI | InChI=1S/C21H29N5O3S/c1-23(2)30(28,29)26(20-7-5-4-6-8-20)17-21(27)22-18-9-11-19(12-10-18)25-15-13-24(3)14-16-25/h4-12H,13-17H2,1-3H3,(H,22,27) |
| InChIKey | AUVQMAZNSUECLR-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|