C13H10N6O2 — CID 5328053
4-N-(3-nitrophenyl)pyrido[4,3-d]pyrimidine-4,7-diamine (PubChem CID 5328053) has the molecular formula C13H10N6O2 and a molecular weight of 282.26 g/mol. Its IUPAC name is 4-N-(3-nitrophenyl)pyrido[4,3-d]pyrimidine-4,7-diamine.
| Compound Name | 4-N-(3-nitrophenyl)pyrido[4,3-d]pyrimidine-4,7-diamine |
|---|---|
| PubChem CID | 5328053 |
| Molecular Formula | C13H10N6O2 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 4-N-(3-nitrophenyl)pyrido[4,3-d]pyrimidine-4,7-diamine |
| SMILES | Nc1cc2ncnc(Nc3cccc([N+](=O)[O-])c3)c2cn1 |
| InChI | InChI=1S/C13H10N6O2/c14-12-5-11-10(6-15-12)13(17-7-16-11)18-8-2-1-3-9(4-8)19(20)21/h1-7H,(H2,14,15)(H,16,17,18) |
| InChIKey | BMZXYZGEVIZRKF-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 119.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|