About 3-[(7-aminopyrido[4,3-d]pyrimidin-4-yl)amino]phenol
3-[(7-aminopyrido[4,3-d]pyrimidin-4-yl)amino]phenol (PubChem CID 5328072) has the molecular formula C13H11N5O
and a molecular weight of 253.27 g/mol. Its IUPAC name is 3-[(7-aminopyrido[4,3-d]pyrimidin-4-yl)amino]phenol.
Molecular Properties
| Compound Name | 3-[(7-aminopyrido[4,3-d]pyrimidin-4-yl)amino]phenol |
| PubChem CID | 5328072 |
| Molecular Formula | C13H11N5O |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 3-[(7-aminopyrido[4,3-d]pyrimidin-4-yl)amino]phenol |
| SMILES | Nc1cc2ncnc(Nc3cccc(O)c3)c2cn1 |
| InChI | InChI=1S/C13H11N5O/c14-12-5-11-10(6-15-12)13(17-7-16-11)18-8-2-1-3-9(19)4-8/h1-7,19H,(H2,14,15)(H,16,17,18) |
| InChIKey | UNRPCVUDZXTDLE-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 96.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[(7-aminopyrido[4,3-d]pyrimidin-4-yl)amino]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(7-aminopyrido[4,3-d]pyrimidin-4-yl)amino]phenol?
The IUPAC name of 3-[(7-aminopyrido[4,3-d]pyrimidin-4-yl)amino]phenol (CID 5328072) is 3-[(7-aminopyrido[4,3-d]pyrimidin-4-yl)amino]phenol.
What is the SMILES notation for 3-[(7-aminopyrido[4,3-d]pyrimidin-4-yl)amino]phenol?
The canonical SMILES for 3-[(7-aminopyrido[4,3-d]pyrimidin-4-yl)amino]phenol is Nc1cc2ncnc(Nc3cccc(O)c3)c2cn1.
What is the InChIKey of 3-[(7-aminopyrido[4,3-d]pyrimidin-4-yl)amino]phenol?
The InChIKey is UNRPCVUDZXTDLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N5O/c14-12-5-11-10(6-15-12)13(17-7-16-11)18-8-2-1-3-9(19)4-8/h1-7,19H,(H2,14,15)(H,16,17,18).
What are the key properties of 3-[(7-aminopyrido[4,3-d]pyrimidin-4-yl)amino]phenol?
3-[(7-aminopyrido[4,3-d]pyrimidin-4-yl)amino]phenol has a molecular weight of 253.27 g/mol, XLogP of 2.06, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(7-aminopyrido[4,3-d]pyrimidin-4-yl)amino]phenol is sourced from PubChem (CID 5328072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).