C13H11N5O — CID 5328072
3-[(7-aminopyrido[4,3-d]pyrimidin-4-yl)amino]phenol (PubChem CID 5328072) has the molecular formula C13H11N5O and a molecular weight of 253.27 g/mol. Its IUPAC name is 3-[(7-aminopyrido[4,3-d]pyrimidin-4-yl)amino]phenol.
| Compound Name | 3-[(7-aminopyrido[4,3-d]pyrimidin-4-yl)amino]phenol |
|---|---|
| PubChem CID | 5328072 |
| Molecular Formula | C13H11N5O |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 3-[(7-aminopyrido[4,3-d]pyrimidin-4-yl)amino]phenol |
| SMILES | Nc1cc2ncnc(Nc3cccc(O)c3)c2cn1 |
| InChI | InChI=1S/C13H11N5O/c14-12-5-11-10(6-15-12)13(17-7-16-11)18-8-2-1-3-9(19)4-8/h1-7,19H,(H2,14,15)(H,16,17,18) |
| InChIKey | UNRPCVUDZXTDLE-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 96.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |