C14H12N6O2 — CID 5328078
4-N-[(2-nitrophenyl)methyl]pyrido[4,3-d]pyrimidine-4,7-diamine (PubChem CID 5328078) has the molecular formula C14H12N6O2 and a molecular weight of 296.29 g/mol. Its IUPAC name is 4-N-[(2-nitrophenyl)methyl]pyrido[4,3-d]pyrimidine-4,7-diamine.
| Compound Name | 4-N-[(2-nitrophenyl)methyl]pyrido[4,3-d]pyrimidine-4,7-diamine |
|---|---|
| PubChem CID | 5328078 |
| Molecular Formula | C14H12N6O2 |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 4-N-[(2-nitrophenyl)methyl]pyrido[4,3-d]pyrimidine-4,7-diamine |
| SMILES | Nc1cc2ncnc(NCc3ccccc3[N+](=O)[O-])c2cn1 |
| InChI | InChI=1S/C14H12N6O2/c15-13-5-11-10(7-16-13)14(19-8-18-11)17-6-9-3-1-2-4-12(9)20(21)22/h1-5,7-8H,6H2,(H2,15,16)(H,17,18,19) |
| InChIKey | CJGIANITKCSLRQ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 119.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|