C14H12BrN5 — CID 5328081
4-N-[(2-bromophenyl)methyl]pyrido[4,3-d]pyrimidine-4,7-diamine (PubChem CID 5328081) has the molecular formula C14H12BrN5 and a molecular weight of 330.19 g/mol. Its IUPAC name is 4-N-[(2-bromophenyl)methyl]pyrido[4,3-d]pyrimidine-4,7-diamine.
| Compound Name | 4-N-[(2-bromophenyl)methyl]pyrido[4,3-d]pyrimidine-4,7-diamine |
|---|---|
| PubChem CID | 5328081 |
| Molecular Formula | C14H12BrN5 |
| Molecular Weight | 330.19 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | 4-N-[(2-bromophenyl)methyl]pyrido[4,3-d]pyrimidine-4,7-diamine |
| SMILES | Nc1cc2ncnc(NCc3ccccc3Br)c2cn1 |
| InChI | InChI=1S/C14H12BrN5/c15-11-4-2-1-3-9(11)6-18-14-10-7-17-13(16)5-12(10)19-8-20-14/h1-5,7-8H,6H2,(H2,16,17)(H,18,19,20) |
| InChIKey | YPHZMMAIKSDRPX-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.19 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |