C14H14N6 — CID 5328090
4-N-[(2-aminophenyl)methyl]pyrido[4,3-d]pyrimidine-4,7-diamine (PubChem CID 5328090) has the molecular formula C14H14N6 and a molecular weight of 266.31 g/mol. Its IUPAC name is 4-N-[(2-aminophenyl)methyl]pyrido[4,3-d]pyrimidine-4,7-diamine.
| Compound Name | 4-N-[(2-aminophenyl)methyl]pyrido[4,3-d]pyrimidine-4,7-diamine |
|---|---|
| PubChem CID | 5328090 |
| Molecular Formula | C14H14N6 |
| Molecular Weight | 266.31 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 4-N-[(2-aminophenyl)methyl]pyrido[4,3-d]pyrimidine-4,7-diamine |
| SMILES | Nc1cc2ncnc(NCc3ccccc3N)c2cn1 |
| InChI | InChI=1S/C14H14N6/c15-11-4-2-1-3-9(11)6-18-14-10-7-17-13(16)5-12(10)19-8-20-14/h1-5,7-8H,6,15H2,(H2,16,17)(H,18,19,20) |
| InChIKey | UOXLBDZHQKWTRJ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.31 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|