About 2-fluoro-N,N-dihexylbenzamide
2-fluoro-N,N-dihexylbenzamide (PubChem CID 532810) has the molecular formula C19H30FNO
and a molecular weight of 307.45 g/mol. Its IUPAC name is 2-fluoro-N,N-dihexylbenzamide.
Molecular Properties
| Compound Name | 2-fluoro-N,N-dihexylbenzamide |
| PubChem CID | 532810 |
| Molecular Formula | C19H30FNO |
| Molecular Weight | 307.45 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | 2-fluoro-N,N-dihexylbenzamide |
| SMILES | CCCCCCN(CCCCCC)C(=O)c1ccccc1F |
| InChI | InChI=1S/C19H30FNO/c1-3-5-7-11-15-21(16-12-8-6-4-2)19(22)17-13-9-10-14-18(17)20/h9-10,13-14H,3-8,11-12,15-16H2,1-2H3 |
| InChIKey | CXVPMARFGIKBFT-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 307.45 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-N,N-dihexylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-N,N-dihexylbenzamide?
The IUPAC name of 2-fluoro-N,N-dihexylbenzamide (CID 532810) is 2-fluoro-N,N-dihexylbenzamide.
What is the SMILES notation for 2-fluoro-N,N-dihexylbenzamide?
The canonical SMILES for 2-fluoro-N,N-dihexylbenzamide is CCCCCCN(CCCCCC)C(=O)c1ccccc1F.
What is the InChIKey of 2-fluoro-N,N-dihexylbenzamide?
The InChIKey is CXVPMARFGIKBFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30FNO/c1-3-5-7-11-15-21(16-12-8-6-4-2)19(22)17-13-9-10-14-18(17)20/h9-10,13-14H,3-8,11-12,15-16H2,1-2H3.
What are the key properties of 2-fluoro-N,N-dihexylbenzamide?
2-fluoro-N,N-dihexylbenzamide has a molecular weight of 307.45 g/mol, XLogP of 5.43, 11 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-N,N-dihexylbenzamide is sourced from PubChem (CID 532810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).