C22H30N6 — CID 5328118
2-N-[3-(diethylamino)propyl]-6-(2,6-dimethylphenyl)pyrido[2,3-d]pyrimidine-2,7-diamine (PubChem CID 5328118) has the molecular formula C22H30N6 and a molecular weight of 378.52 g/mol. Its IUPAC name is 2-N-[3-(diethylamino)propyl]-6-(2,6-dimethylphenyl)pyrido[2,3-d]pyrimidine-2,7-diamine.
| Compound Name | 2-N-[3-(diethylamino)propyl]-6-(2,6-dimethylphenyl)pyrido[2,3-d]pyrimidine-2,7-diamine |
|---|---|
| PubChem CID | 5328118 |
| Molecular Formula | C22H30N6 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.25 |
| IUPAC Name | 2-N-[3-(diethylamino)propyl]-6-(2,6-dimethylphenyl)pyrido[2,3-d]pyrimidine-2,7-diamine |
| SMILES | CCN(CC)CCCNc1ncc2cc(-c3c(C)cccc3C)c(N)nc2n1 |
| InChI | InChI=1S/C22H30N6/c1-5-28(6-2)12-8-11-24-22-25-14-17-13-18(20(23)26-21(17)27-22)19-15(3)9-7-10-16(19)4/h7,9-10,13-14H,5-6,8,11-12H2,1-4H3,(H3,23,24,25,26,27) |
| InChIKey | MAHHICHAEAGUTG-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|