C27H39N7O — CID 5328119
1-tert-butyl-3-[2-[3-(diethylamino)propylamino]-6-(2,6-dimethylphenyl)pyrido[2,3-d]pyrimidin-7-yl]urea (PubChem CID 5328119) has the molecular formula C27H39N7O and a molecular weight of 477.66 g/mol. Its IUPAC name is 1-tert-butyl-3-[2-[3-(diethylamino)propylamino]-6-(2,6-dimethylphenyl)pyrido[2,3-d]pyrimidin-7-yl]urea.
| Compound Name | 1-tert-butyl-3-[2-[3-(diethylamino)propylamino]-6-(2,6-dimethylphenyl)pyrido[2,3-d]pyrimidin-7-yl]urea |
|---|---|
| PubChem CID | 5328119 |
| Molecular Formula | C27H39N7O |
| Molecular Weight | 477.66 g/mol |
| Exact Mass | 477.32 |
| IUPAC Name | 1-tert-butyl-3-[2-[3-(diethylamino)propylamino]-6-(2,6-dimethylphenyl)pyrido[2,3-d]pyrimidin-7-yl]urea |
| SMILES | CCN(CC)CCCNc1ncc2cc(-c3c(C)cccc3C)c(NC(=O)NC(C)(C)C)nc2n1 |
| InChI | InChI=1S/C27H39N7O/c1-8-34(9-2)15-11-14-28-25-29-17-20-16-21(22-18(3)12-10-13-19(22)4)24(30-23(20)31-25)32-26(35)33-27(5,6)7/h10,12-13,16-17H,8-9,11,14-15H2,1-7H3,(H3,28,29,30,31,32,33,35) |
| InChIKey | VCNDNCLJYTUPOX-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 95.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.66 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|