C20H24Br2N6 — CID 5328122
6-(2,6-dibromophenyl)-2-N-[3-(diethylamino)propyl]pyrido[2,3-d]pyrimidine-2,7-diamine (PubChem CID 5328122) has the molecular formula C20H24Br2N6 and a molecular weight of 508.26 g/mol. Its IUPAC name is 6-(2,6-dibromophenyl)-2-N-[3-(diethylamino)propyl]pyrido[2,3-d]pyrimidine-2,7-diamine.
| Compound Name | 6-(2,6-dibromophenyl)-2-N-[3-(diethylamino)propyl]pyrido[2,3-d]pyrimidine-2,7-diamine |
|---|---|
| PubChem CID | 5328122 |
| Molecular Formula | C20H24Br2N6 |
| Molecular Weight | 508.26 g/mol |
| Exact Mass | 506.04 |
| IUPAC Name | 6-(2,6-dibromophenyl)-2-N-[3-(diethylamino)propyl]pyrido[2,3-d]pyrimidine-2,7-diamine |
| SMILES | CCN(CC)CCCNc1ncc2cc(-c3c(Br)cccc3Br)c(N)nc2n1 |
| InChI | InChI=1S/C20H24Br2N6/c1-3-28(4-2)10-6-9-24-20-25-12-13-11-14(18(23)26-19(13)27-20)17-15(21)7-5-8-16(17)22/h5,7-8,11-12H,3-4,6,9-10H2,1-2H3,(H3,23,24,25,26,27) |
| InChIKey | KICNNRAJZZOWST-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.26 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|