C25H31Cl2N7O2 — CID 5328145
1-tert-butyl-3-[6-(2,6-dichlorophenyl)-2-(3-morpholin-4-ylpropylamino)pyrido[2,3-d]pyrimidin-7-yl]urea (PubChem CID 5328145) has the molecular formula C25H31Cl2N7O2 and a molecular weight of 532.48 g/mol. Its IUPAC name is 1-tert-butyl-3-[6-(2,6-dichlorophenyl)-2-(3-morpholin-4-ylpropylamino)pyrido[2,3-d]pyrimidin-7-yl]urea.
| Compound Name | 1-tert-butyl-3-[6-(2,6-dichlorophenyl)-2-(3-morpholin-4-ylpropylamino)pyrido[2,3-d]pyrimidin-7-yl]urea |
|---|---|
| PubChem CID | 5328145 |
| Molecular Formula | C25H31Cl2N7O2 |
| Molecular Weight | 532.48 g/mol |
| Exact Mass | 531.19 |
| IUPAC Name | 1-tert-butyl-3-[6-(2,6-dichlorophenyl)-2-(3-morpholin-4-ylpropylamino)pyrido[2,3-d]pyrimidin-7-yl]urea |
| SMILES | CC(C)(C)NC(=O)Nc1nc2nc(NCCCN3CCOCC3)ncc2cc1-c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C25H31Cl2N7O2/c1-25(2,3)33-24(35)32-22-17(20-18(26)6-4-7-19(20)27)14-16-15-29-23(31-21(16)30-22)28-8-5-9-34-10-12-36-13-11-34/h4,6-7,14-15H,5,8-13H2,1-3H3,(H3,28,29,30,31,32,33,35) |
| InChIKey | QJIICVSRCKDXPF-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 104.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.48 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|