C21H25Cl2N7 — CID 5328148
6-(2,6-dichlorophenyl)-2-N-[3-(4-methylpiperazin-1-yl)propyl]pyrido[2,3-d]pyrimidine-2,7-diamine (PubChem CID 5328148) has the molecular formula C21H25Cl2N7 and a molecular weight of 446.39 g/mol. Its IUPAC name is 6-(2,6-dichlorophenyl)-2-N-[3-(4-methylpiperazin-1-yl)propyl]pyrido[2,3-d]pyrimidine-2,7-diamine.
| Compound Name | 6-(2,6-dichlorophenyl)-2-N-[3-(4-methylpiperazin-1-yl)propyl]pyrido[2,3-d]pyrimidine-2,7-diamine |
|---|---|
| PubChem CID | 5328148 |
| Molecular Formula | C21H25Cl2N7 |
| Molecular Weight | 446.39 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | 6-(2,6-dichlorophenyl)-2-N-[3-(4-methylpiperazin-1-yl)propyl]pyrido[2,3-d]pyrimidine-2,7-diamine |
| SMILES | CN1CCN(CCCNc2ncc3cc(-c4c(Cl)cccc4Cl)c(N)nc3n2)CC1 |
| InChI | InChI=1S/C21H25Cl2N7/c1-29-8-10-30(11-9-29)7-3-6-25-21-26-13-14-12-15(19(24)27-20(14)28-21)18-16(22)4-2-5-17(18)23/h2,4-5,12-13H,3,6-11H2,1H3,(H3,24,25,26,27,28) |
| InChIKey | GFIUKKVYDDTJLV-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 83.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.39 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|