C26H34Cl2N8O — CID 5328149
1-tert-butyl-3-[6-(2,6-dichlorophenyl)-2-[3-(4-methylpiperazin-1-yl)propylamino]pyrido[2,3-d]pyrimidin-7-yl]urea (PubChem CID 5328149) has the molecular formula C26H34Cl2N8O and a molecular weight of 545.52 g/mol. Its IUPAC name is 1-tert-butyl-3-[6-(2,6-dichlorophenyl)-2-[3-(4-methylpiperazin-1-yl)propylamino]pyrido[2,3-d]pyrimidin-7-yl]urea.
| Compound Name | 1-tert-butyl-3-[6-(2,6-dichlorophenyl)-2-[3-(4-methylpiperazin-1-yl)propylamino]pyrido[2,3-d]pyrimidin-7-yl]urea |
|---|---|
| PubChem CID | 5328149 |
| Molecular Formula | C26H34Cl2N8O |
| Molecular Weight | 545.52 g/mol |
| Exact Mass | 544.22 |
| IUPAC Name | 1-tert-butyl-3-[6-(2,6-dichlorophenyl)-2-[3-(4-methylpiperazin-1-yl)propylamino]pyrido[2,3-d]pyrimidin-7-yl]urea |
| SMILES | CN1CCN(CCCNc2ncc3cc(-c4c(Cl)cccc4Cl)c(NC(=O)NC(C)(C)C)nc3n2)CC1 |
| InChI | InChI=1S/C26H34Cl2N8O/c1-26(2,3)34-25(37)33-23-18(21-19(27)7-5-8-20(21)28)15-17-16-30-24(32-22(17)31-23)29-9-6-10-36-13-11-35(4)12-14-36/h5,7-8,15-16H,6,9-14H2,1-4H3,(H3,29,30,31,32,33,34,37) |
| InChIKey | PAZDFSJAERQBCY-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.52 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|