C24H30Cl2N8O — CID 5328153
1-[6-(2,6-dichlorophenyl)-2-[3-(4-methylpiperazin-1-yl)propylamino]pyrido[2,3-d]pyrimidin-7-yl]-3-ethylurea (PubChem CID 5328153) has the molecular formula C24H30Cl2N8O and a molecular weight of 517.47 g/mol. Its IUPAC name is 1-[6-(2,6-dichlorophenyl)-2-[3-(4-methylpiperazin-1-yl)propylamino]pyrido[2,3-d]pyrimidin-7-yl]-3-ethylurea.
| Compound Name | 1-[6-(2,6-dichlorophenyl)-2-[3-(4-methylpiperazin-1-yl)propylamino]pyrido[2,3-d]pyrimidin-7-yl]-3-ethylurea |
|---|---|
| PubChem CID | 5328153 |
| Molecular Formula | C24H30Cl2N8O |
| Molecular Weight | 517.47 g/mol |
| Exact Mass | 516.19 |
| IUPAC Name | 1-[6-(2,6-dichlorophenyl)-2-[3-(4-methylpiperazin-1-yl)propylamino]pyrido[2,3-d]pyrimidin-7-yl]-3-ethylurea |
| SMILES | CCNC(=O)Nc1nc2nc(NCCCN3CCN(C)CC3)ncc2cc1-c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C24H30Cl2N8O/c1-3-27-24(35)32-22-17(20-18(25)6-4-7-19(20)26)14-16-15-29-23(31-21(16)30-22)28-8-5-9-34-12-10-33(2)11-13-34/h4,6-7,14-15H,3,5,8-13H2,1-2H3,(H3,27,28,29,30,31,32,35) |
| InChIKey | ZAPMLUQRTGRJST-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.47 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|