C29H32Cl2N8O — CID 5328157
1-benzyl-3-[6-(2,6-dichlorophenyl)-2-[3-(4-methylpiperazin-1-yl)propylamino]pyrido[2,3-d]pyrimidin-7-yl]urea (PubChem CID 5328157) has the molecular formula C29H32Cl2N8O and a molecular weight of 579.54 g/mol. Its IUPAC name is 1-benzyl-3-[6-(2,6-dichlorophenyl)-2-[3-(4-methylpiperazin-1-yl)propylamino]pyrido[2,3-d]pyrimidin-7-yl]urea.
| Compound Name | 1-benzyl-3-[6-(2,6-dichlorophenyl)-2-[3-(4-methylpiperazin-1-yl)propylamino]pyrido[2,3-d]pyrimidin-7-yl]urea |
|---|---|
| PubChem CID | 5328157 |
| Molecular Formula | C29H32Cl2N8O |
| Molecular Weight | 579.54 g/mol |
| Exact Mass | 578.21 |
| IUPAC Name | 1-benzyl-3-[6-(2,6-dichlorophenyl)-2-[3-(4-methylpiperazin-1-yl)propylamino]pyrido[2,3-d]pyrimidin-7-yl]urea |
| SMILES | CN1CCN(CCCNc2ncc3cc(-c4c(Cl)cccc4Cl)c(NC(=O)NCc4ccccc4)nc3n2)CC1 |
| InChI | InChI=1S/C29H32Cl2N8O/c1-38-13-15-39(16-14-38)12-6-11-32-28-33-19-21-17-22(25-23(30)9-5-10-24(25)31)27(35-26(21)36-28)37-29(40)34-18-20-7-3-2-4-8-20/h2-5,7-10,17,19H,6,11-16,18H2,1H3,(H3,32,33,34,35,36,37,40) |
| InChIKey | XARWOHKDCBRPBQ-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.54 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|