C28H29Cl3N8O — CID 5328164
1-(4-chlorophenyl)-3-[6-(2,6-dichlorophenyl)-2-[3-(4-methylpiperazin-1-yl)propylamino]pyrido[2,3-d]pyrimidin-7-yl]urea (PubChem CID 5328164) has the molecular formula C28H29Cl3N8O and a molecular weight of 599.95 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[6-(2,6-dichlorophenyl)-2-[3-(4-methylpiperazin-1-yl)propylamino]pyrido[2,3-d]pyrimidin-7-yl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[6-(2,6-dichlorophenyl)-2-[3-(4-methylpiperazin-1-yl)propylamino]pyrido[2,3-d]pyrimidin-7-yl]urea |
|---|---|
| PubChem CID | 5328164 |
| Molecular Formula | C28H29Cl3N8O |
| Molecular Weight | 599.95 g/mol |
| Exact Mass | 598.15 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[6-(2,6-dichlorophenyl)-2-[3-(4-methylpiperazin-1-yl)propylamino]pyrido[2,3-d]pyrimidin-7-yl]urea |
| SMILES | CN1CCN(CCCNc2ncc3cc(-c4c(Cl)cccc4Cl)c(NC(=O)Nc4ccc(Cl)cc4)nc3n2)CC1 |
| InChI | InChI=1S/C28H29Cl3N8O/c1-38-12-14-39(15-13-38)11-3-10-32-27-33-17-18-16-21(24-22(30)4-2-5-23(24)31)26(35-25(18)36-27)37-28(40)34-20-8-6-19(29)7-9-20/h2,4-9,16-17H,3,10-15H2,1H3,(H3,32,33,34,35,36,37,40) |
| InChIKey | JEPFUEYLCGNLKG-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.95 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|