C29H32Cl2N8O2 — CID 5328171
1-[6-(2,6-dichlorophenyl)-2-[3-(4-methylpiperazin-1-yl)propylamino]pyrido[2,3-d]pyrimidin-7-yl]-3-(4-methoxyphenyl)urea (PubChem CID 5328171) has the molecular formula C29H32Cl2N8O2 and a molecular weight of 595.54 g/mol. Its IUPAC name is 1-[6-(2,6-dichlorophenyl)-2-[3-(4-methylpiperazin-1-yl)propylamino]pyrido[2,3-d]pyrimidin-7-yl]-3-(4-methoxyphenyl)urea.
| Compound Name | 1-[6-(2,6-dichlorophenyl)-2-[3-(4-methylpiperazin-1-yl)propylamino]pyrido[2,3-d]pyrimidin-7-yl]-3-(4-methoxyphenyl)urea |
|---|---|
| PubChem CID | 5328171 |
| Molecular Formula | C29H32Cl2N8O2 |
| Molecular Weight | 595.54 g/mol |
| Exact Mass | 594.20 |
| IUPAC Name | 1-[6-(2,6-dichlorophenyl)-2-[3-(4-methylpiperazin-1-yl)propylamino]pyrido[2,3-d]pyrimidin-7-yl]-3-(4-methoxyphenyl)urea |
| SMILES | COc1ccc(NC(=O)Nc2nc3nc(NCCCN4CCN(C)CC4)ncc3cc2-c2c(Cl)cccc2Cl)cc1 |
| InChI | InChI=1S/C29H32Cl2N8O2/c1-38-13-15-39(16-14-38)12-4-11-32-28-33-18-19-17-22(25-23(30)5-3-6-24(25)31)27(35-26(19)36-28)37-29(40)34-20-7-9-21(41-2)10-8-20/h3,5-10,17-18H,4,11-16H2,1-2H3,(H3,32,33,34,35,36,37,40) |
| InChIKey | LVEXBQONPVYXPA-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 107.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.54 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|