C32H32Cl2N8O — CID 5328172
1-[6-(2,6-dichlorophenyl)-2-[3-(4-methylpiperazin-1-yl)propylamino]pyrido[2,3-d]pyrimidin-7-yl]-3-naphthalen-1-ylurea (PubChem CID 5328172) has the molecular formula C32H32Cl2N8O and a molecular weight of 615.57 g/mol. Its IUPAC name is 1-[6-(2,6-dichlorophenyl)-2-[3-(4-methylpiperazin-1-yl)propylamino]pyrido[2,3-d]pyrimidin-7-yl]-3-naphthalen-1-ylurea.
| Compound Name | 1-[6-(2,6-dichlorophenyl)-2-[3-(4-methylpiperazin-1-yl)propylamino]pyrido[2,3-d]pyrimidin-7-yl]-3-naphthalen-1-ylurea |
|---|---|
| PubChem CID | 5328172 |
| Molecular Formula | C32H32Cl2N8O |
| Molecular Weight | 615.57 g/mol |
| Exact Mass | 614.21 |
| IUPAC Name | 1-[6-(2,6-dichlorophenyl)-2-[3-(4-methylpiperazin-1-yl)propylamino]pyrido[2,3-d]pyrimidin-7-yl]-3-naphthalen-1-ylurea |
| SMILES | CN1CCN(CCCNc2ncc3cc(-c4c(Cl)cccc4Cl)c(NC(=O)Nc4cccc5ccccc45)nc3n2)CC1 |
| InChI | InChI=1S/C32H32Cl2N8O/c1-41-15-17-42(18-16-41)14-6-13-35-31-36-20-22-19-24(28-25(33)10-5-11-26(28)34)30(38-29(22)39-31)40-32(43)37-27-12-4-8-21-7-2-3-9-23(21)27/h2-5,7-12,19-20H,6,13-18H2,1H3,(H3,35,36,37,38,39,40,43) |
| InChIKey | ODSISTOLPDZKMR-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.57 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|