C23H29Cl2N7S — CID 5328175
1-[6-(2,6-dichlorophenyl)-2-[3-(diethylamino)propylamino]pyrido[2,3-d]pyrimidin-7-yl]-3-ethylthiourea (PubChem CID 5328175) has the molecular formula C23H29Cl2N7S and a molecular weight of 506.51 g/mol. Its IUPAC name is 1-[6-(2,6-dichlorophenyl)-2-[3-(diethylamino)propylamino]pyrido[2,3-d]pyrimidin-7-yl]-3-ethylthiourea.
| Compound Name | 1-[6-(2,6-dichlorophenyl)-2-[3-(diethylamino)propylamino]pyrido[2,3-d]pyrimidin-7-yl]-3-ethylthiourea |
|---|---|
| PubChem CID | 5328175 |
| Molecular Formula | C23H29Cl2N7S |
| Molecular Weight | 506.51 g/mol |
| Exact Mass | 505.16 |
| IUPAC Name | 1-[6-(2,6-dichlorophenyl)-2-[3-(diethylamino)propylamino]pyrido[2,3-d]pyrimidin-7-yl]-3-ethylthiourea |
| SMILES | CCNC(=S)Nc1nc2nc(NCCCN(CC)CC)ncc2cc1-c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C23H29Cl2N7S/c1-4-26-23(33)31-21-16(19-17(24)9-7-10-18(19)25)13-15-14-28-22(30-20(15)29-21)27-11-8-12-32(5-2)6-3/h7,9-10,13-14H,4-6,8,11-12H2,1-3H3,(H3,26,27,28,29,30,31,33) |
| InChIKey | HFLUEICUUCYLAK-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 78.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.51 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|