C28H39Cl2N9 — CID 5328183
1-[6-(2,6-dichlorophenyl)-2-[3-(4-methylpiperazin-1-yl)propylamino]pyrido[2,3-d]pyrimidin-7-yl]-2,3-di(propan-2-yl)guanidine (PubChem CID 5328183) has the molecular formula C28H39Cl2N9 and a molecular weight of 572.59 g/mol. Its IUPAC name is 1-[6-(2,6-dichlorophenyl)-2-[3-(4-methylpiperazin-1-yl)propylamino]pyrido[2,3-d]pyrimidin-7-yl]-2,3-di(propan-2-yl)guanidine.
| Compound Name | 1-[6-(2,6-dichlorophenyl)-2-[3-(4-methylpiperazin-1-yl)propylamino]pyrido[2,3-d]pyrimidin-7-yl]-2,3-di(propan-2-yl)guanidine |
|---|---|
| PubChem CID | 5328183 |
| Molecular Formula | C28H39Cl2N9 |
| Molecular Weight | 572.59 g/mol |
| Exact Mass | 571.27 |
| IUPAC Name | 1-[6-(2,6-dichlorophenyl)-2-[3-(4-methylpiperazin-1-yl)propylamino]pyrido[2,3-d]pyrimidin-7-yl]-2,3-di(propan-2-yl)guanidine |
| SMILES | CC(C)/N=C(/Nc1nc2nc(NCCCN3CCN(C)CC3)ncc2cc1-c1c(Cl)cccc1Cl)NC(C)C |
| InChI | InChI=1S/C28H39Cl2N9/c1-18(2)33-28(34-19(3)4)37-26-21(24-22(29)8-6-9-23(24)30)16-20-17-32-27(36-25(20)35-26)31-10-7-11-39-14-12-38(5)13-15-39/h6,8-9,16-19H,7,10-15H2,1-5H3,(H3,31,32,33,34,35,36,37) |
| InChIKey | REFGSJLMEHGIDI-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 93.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.59 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|