C16H16BrN5 — CID 5328211
4-N-(3-bromophenyl)-7-N,7-N-dimethylquinazoline-4,6,7-triamine (PubChem CID 5328211) has the molecular formula C16H16BrN5 and a molecular weight of 358.24 g/mol. Its IUPAC name is 4-N-(3-bromophenyl)-7-N,7-N-dimethylquinazoline-4,6,7-triamine.
| Compound Name | 4-N-(3-bromophenyl)-7-N,7-N-dimethylquinazoline-4,6,7-triamine |
|---|---|
| PubChem CID | 5328211 |
| Molecular Formula | C16H16BrN5 |
| Molecular Weight | 358.24 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | 4-N-(3-bromophenyl)-7-N,7-N-dimethylquinazoline-4,6,7-triamine |
| SMILES | CN(C)c1cc2ncnc(Nc3cccc(Br)c3)c2cc1N |
| InChI | InChI=1S/C16H16BrN5/c1-22(2)15-8-14-12(7-13(15)18)16(20-9-19-14)21-11-5-3-4-10(17)6-11/h3-9H,18H2,1-2H3,(H,19,20,21) |
| InChIKey | LVYWXEWYKYOVOX-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.24 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|