About N-(3-bromophenyl)-6,7-dipropoxyquinazolin-4-amine
N-(3-bromophenyl)-6,7-dipropoxyquinazolin-4-amine (PubChem CID 5328221) has the molecular formula C20H22BrN3O2
and a molecular weight of 416.32 g/mol. Its IUPAC name is N-(3-bromophenyl)-6,7-dipropoxyquinazolin-4-amine.
Molecular Properties
| Compound Name | N-(3-bromophenyl)-6,7-dipropoxyquinazolin-4-amine |
| PubChem CID | 5328221 |
| Molecular Formula | C20H22BrN3O2 |
| Molecular Weight | 416.32 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | N-(3-bromophenyl)-6,7-dipropoxyquinazolin-4-amine |
| SMILES | CCCOc1cc2ncnc(Nc3cccc(Br)c3)c2cc1OCCC |
| InChI | InChI=1S/C20H22BrN3O2/c1-3-8-25-18-11-16-17(12-19(18)26-9-4-2)22-13-23-20(16)24-15-7-5-6-14(21)10-15/h5-7,10-13H,3-4,8-9H2,1-2H3,(H,22,23,24) |
| InChIKey | ZBOJKFDQWQBBHE-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.32 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(3-bromophenyl)-6,7-dipropoxyquinazolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-bromophenyl)-6,7-dipropoxyquinazolin-4-amine?
The IUPAC name of N-(3-bromophenyl)-6,7-dipropoxyquinazolin-4-amine (CID 5328221) is N-(3-bromophenyl)-6,7-dipropoxyquinazolin-4-amine.
What is the SMILES notation for N-(3-bromophenyl)-6,7-dipropoxyquinazolin-4-amine?
The canonical SMILES for N-(3-bromophenyl)-6,7-dipropoxyquinazolin-4-amine is CCCOc1cc2ncnc(Nc3cccc(Br)c3)c2cc1OCCC.
What is the InChIKey of N-(3-bromophenyl)-6,7-dipropoxyquinazolin-4-amine?
The InChIKey is ZBOJKFDQWQBBHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22BrN3O2/c1-3-8-25-18-11-16-17(12-19(18)26-9-4-2)22-13-23-20(16)24-15-7-5-6-14(21)10-15/h5-7,10-13H,3-4,8-9H2,1-2H3,(H,22,23,24).
What are the key properties of N-(3-bromophenyl)-6,7-dipropoxyquinazolin-4-amine?
N-(3-bromophenyl)-6,7-dipropoxyquinazolin-4-amine has a molecular weight of 416.32 g/mol, XLogP of 5.71, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-bromophenyl)-6,7-dipropoxyquinazolin-4-amine is sourced from PubChem (CID 5328221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).