C15H20N2O5S — CID 53282255
4-[1,3-benzodioxol-5-yl(methylsulfonyl)amino]-N-cyclopropylbutanamide (PubChem CID 53282255) has the molecular formula C15H20N2O5S and a molecular weight of 340.40 g/mol. Its IUPAC name is 4-[1,3-benzodioxol-5-yl(methylsulfonyl)amino]-N-cyclopropylbutanamide.
| Compound Name | 4-[1,3-benzodioxol-5-yl(methylsulfonyl)amino]-N-cyclopropylbutanamide |
|---|---|
| PubChem CID | 53282255 |
| Molecular Formula | C15H20N2O5S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 4-[1,3-benzodioxol-5-yl(methylsulfonyl)amino]-N-cyclopropylbutanamide |
| SMILES | CS(=O)(=O)N(CCCC(=O)NC1CC1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H20N2O5S/c1-23(19,20)17(8-2-3-15(18)16-11-4-5-11)12-6-7-13-14(9-12)22-10-21-13/h6-7,9,11H,2-5,8,10H2,1H3,(H,16,18) |
| InChIKey | CRTYRJSQHOKJNT-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |