About N-(3-bromophenyl)-[1,3]thiazolo[5,4-g]quinazolin-8-amine
N-(3-bromophenyl)-[1,3]thiazolo[5,4-g]quinazolin-8-amine (PubChem CID 5328240) has the molecular formula C15H9BrN4S
and a molecular weight of 357.24 g/mol. Its IUPAC name is N-(3-bromophenyl)-[1,3]thiazolo[5,4-g]quinazolin-8-amine.
Molecular Properties
| Compound Name | N-(3-bromophenyl)-[1,3]thiazolo[5,4-g]quinazolin-8-amine |
| PubChem CID | 5328240 |
| Molecular Formula | C15H9BrN4S |
| Molecular Weight | 357.24 g/mol |
| Exact Mass | 355.97 |
| IUPAC Name | N-(3-bromophenyl)-[1,3]thiazolo[5,4-g]quinazolin-8-amine |
| SMILES | Brc1cccc(Nc2ncnc3cc4ncsc4cc23)c1 |
| InChI | InChI=1S/C15H9BrN4S/c16-9-2-1-3-10(4-9)20-15-11-5-14-13(19-8-21-14)6-12(11)17-7-18-15/h1-8H,(H,17,18,20) |
| InChIKey | IRGSEHJOWJXKPV-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.24 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(3-bromophenyl)-[1,3]thiazolo[5,4-g]quinazolin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-bromophenyl)-[1,3]thiazolo[5,4-g]quinazolin-8-amine?
The IUPAC name of N-(3-bromophenyl)-[1,3]thiazolo[5,4-g]quinazolin-8-amine (CID 5328240) is N-(3-bromophenyl)-[1,3]thiazolo[5,4-g]quinazolin-8-amine.
What is the SMILES notation for N-(3-bromophenyl)-[1,3]thiazolo[5,4-g]quinazolin-8-amine?
The canonical SMILES for N-(3-bromophenyl)-[1,3]thiazolo[5,4-g]quinazolin-8-amine is Brc1cccc(Nc2ncnc3cc4ncsc4cc23)c1.
What is the InChIKey of N-(3-bromophenyl)-[1,3]thiazolo[5,4-g]quinazolin-8-amine?
The InChIKey is IRGSEHJOWJXKPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9BrN4S/c16-9-2-1-3-10(4-9)20-15-11-5-14-13(19-8-21-14)6-12(11)17-7-18-15/h1-8H,(H,17,18,20).
What are the key properties of N-(3-bromophenyl)-[1,3]thiazolo[5,4-g]quinazolin-8-amine?
N-(3-bromophenyl)-[1,3]thiazolo[5,4-g]quinazolin-8-amine has a molecular weight of 357.24 g/mol, XLogP of 4.75, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-bromophenyl)-[1,3]thiazolo[5,4-g]quinazolin-8-amine is sourced from PubChem (CID 5328240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).