C13H8BrFN4 — CID 5328268
N-(3-bromophenyl)-7-fluoropyrido[2,3-d]pyrimidin-4-amine (PubChem CID 5328268) has the molecular formula C13H8BrFN4 and a molecular weight of 319.14 g/mol. Its IUPAC name is N-(3-bromophenyl)-7-fluoropyrido[2,3-d]pyrimidin-4-amine.
| Compound Name | N-(3-bromophenyl)-7-fluoropyrido[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 5328268 |
| Molecular Formula | C13H8BrFN4 |
| Molecular Weight | 319.14 g/mol |
| Exact Mass | 317.99 |
| IUPAC Name | N-(3-bromophenyl)-7-fluoropyrido[2,3-d]pyrimidin-4-amine |
| SMILES | Fc1ccc2c(Nc3cccc(Br)c3)ncnc2n1 |
| InChI | InChI=1S/C13H8BrFN4/c14-8-2-1-3-9(6-8)18-12-10-4-5-11(15)19-13(10)17-7-16-12/h1-7H,(H,16,17,18,19) |
| InChIKey | DVVACVMEJKXNQG-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.14 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|