About N-(3-bromophenyl)-8-(2-morpholin-4-ylethyl)pyrrolo[3,2-g]quinazolin-4-amine
N-(3-bromophenyl)-8-(2-morpholin-4-ylethyl)pyrrolo[3,2-g]quinazolin-4-amine (PubChem CID 5328289) has the molecular formula C22H22BrN5O
and a molecular weight of 452.36 g/mol. Its IUPAC name is N-(3-bromophenyl)-8-(2-morpholin-4-ylethyl)pyrrolo[3,2-g]quinazolin-4-amine.
Molecular Properties
| Compound Name | N-(3-bromophenyl)-8-(2-morpholin-4-ylethyl)pyrrolo[3,2-g]quinazolin-4-amine |
| PubChem CID | 5328289 |
| Molecular Formula | C22H22BrN5O |
| Molecular Weight | 452.36 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | N-(3-bromophenyl)-8-(2-morpholin-4-ylethyl)pyrrolo[3,2-g]quinazolin-4-amine |
| SMILES | Brc1cccc(Nc2ncnc3cc4c(ccn4CCN4CCOCC4)cc23)c1 |
| InChI | InChI=1S/C22H22BrN5O/c23-17-2-1-3-18(13-17)26-22-19-12-16-4-5-28(7-6-27-8-10-29-11-9-27)21(16)14-20(19)24-15-25-22/h1-5,12-15H,6-11H2,(H,24,25,26) |
| InChIKey | SZOXQULADAMXOQ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 452.36 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(3-bromophenyl)-8-(2-morpholin-4-ylethyl)pyrrolo[3,2-g]quinazolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-bromophenyl)-8-(2-morpholin-4-ylethyl)pyrrolo[3,2-g]quinazolin-4-amine?
The IUPAC name of N-(3-bromophenyl)-8-(2-morpholin-4-ylethyl)pyrrolo[3,2-g]quinazolin-4-amine (CID 5328289) is N-(3-bromophenyl)-8-(2-morpholin-4-ylethyl)pyrrolo[3,2-g]quinazolin-4-amine.
What is the SMILES notation for N-(3-bromophenyl)-8-(2-morpholin-4-ylethyl)pyrrolo[3,2-g]quinazolin-4-amine?
The canonical SMILES for N-(3-bromophenyl)-8-(2-morpholin-4-ylethyl)pyrrolo[3,2-g]quinazolin-4-amine is Brc1cccc(Nc2ncnc3cc4c(ccn4CCN4CCOCC4)cc23)c1.
What is the InChIKey of N-(3-bromophenyl)-8-(2-morpholin-4-ylethyl)pyrrolo[3,2-g]quinazolin-4-amine?
The InChIKey is SZOXQULADAMXOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22BrN5O/c23-17-2-1-3-18(13-17)26-22-19-12-16-4-5-28(7-6-27-8-10-29-11-9-27)21(16)14-20(19)24-15-25-22/h1-5,12-15H,6-11H2,(H,24,25,26).
What are the key properties of N-(3-bromophenyl)-8-(2-morpholin-4-ylethyl)pyrrolo[3,2-g]quinazolin-4-amine?
N-(3-bromophenyl)-8-(2-morpholin-4-ylethyl)pyrrolo[3,2-g]quinazolin-4-amine has a molecular weight of 452.36 g/mol, XLogP of 4.42, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-bromophenyl)-8-(2-morpholin-4-ylethyl)pyrrolo[3,2-g]quinazolin-4-amine is sourced from PubChem (CID 5328289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).